C35H48N4O3S — CID 145162761
4-[(4E)-4-[(2E)-2-(3,3-dimethyl-1-propylindol-2-ylidene)ethylidene]-3-methyl-5-oxopyrazol-1-yl]-N-(2-ethyloctyl)benzenesulfonamide (PubChem CID 145162761) has the molecular formula C35H48N4O3S and a molecular weight of 604.86 g/mol. Its IUPAC name is 4-[(4E)-4-[(2E)-2-(3,3-dimethyl-1-propylindol-2-ylidene)ethylidene]-3-methyl-5-oxopyrazol-1-yl]-N-(2-ethyloctyl)benzenesulfonamide.
| Compound Name | 4-[(4E)-4-[(2E)-2-(3,3-dimethyl-1-propylindol-2-ylidene)ethylidene]-3-methyl-5-oxopyrazol-1-yl]-N-(2-ethyloctyl)benzenesulfonamide |
|---|---|
| PubChem CID | 145162761 |
| Molecular Formula | C35H48N4O3S |
| Molecular Weight | 604.86 g/mol |
| Exact Mass | 604.34 |
| IUPAC Name | 4-[(4E)-4-[(2E)-2-(3,3-dimethyl-1-propylindol-2-ylidene)ethylidene]-3-methyl-5-oxopyrazol-1-yl]-N-(2-ethyloctyl)benzenesulfonamide |
| SMILES | CCCCCCC(CC)CNS(=O)(=O)c1ccc(N2N=C(C)/C(=C\C=C3\N(CCC)c4ccccc4C3(C)C)C2=O)cc1 |
| InChI | InChI=1S/C35H48N4O3S/c1-7-10-11-12-15-27(9-3)25-36-43(41,42)29-20-18-28(19-21-29)39-34(40)30(26(4)37-39)22-23-33-35(5,6)31-16-13-14-17-32(31)38(33)24-8-2/h13-14,16-23,27,36H,7-12,15,24-25H2,1-6H3/b30-22+,33-23+ |
| InChIKey | DRZLCSDIAUNBNV-PPCYMGOFSA-N |
| XLogP | 7.70 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.86 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|