C26H27N3O10S3 — CID 25255026
(2E)-3,3-dimethyl-2-[(E,4Z)-4-[3-methyl-5-oxo-1-(4-sulfophenyl)pyrazol-4-ylidene]but-2-enylidene]-1-(2-sulfoethyl)indole-5-sulfonic acid (PubChem CID 25255026) has the molecular formula C26H27N3O10S3 and a molecular weight of 637.71 g/mol. Its IUPAC name is (2E)-3,3-dimethyl-2-[(E,4Z)-4-[3-methyl-5-oxo-1-(4-sulfophenyl)pyrazol-4-ylidene]but-2-enylidene]-1-(2-sulfoethyl)indole-5-sulfonic acid.
| Compound Name | (2E)-3,3-dimethyl-2-[(E,4Z)-4-[3-methyl-5-oxo-1-(4-sulfophenyl)pyrazol-4-ylidene]but-2-enylidene]-1-(2-sulfoethyl)indole-5-sulfonic acid |
|---|---|
| PubChem CID | 25255026 |
| Molecular Formula | C26H27N3O10S3 |
| Molecular Weight | 637.71 g/mol |
| Exact Mass | 637.09 |
| IUPAC Name | (2E)-3,3-dimethyl-2-[(E,4Z)-4-[3-methyl-5-oxo-1-(4-sulfophenyl)pyrazol-4-ylidene]but-2-enylidene]-1-(2-sulfoethyl)indole-5-sulfonic acid |
| SMILES | CC1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)/C1=C\C=C\C=C1\N(CCS(=O)(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)C |
| InChI | InChI=1S/C26H27N3O10S3/c1-17-21(25(30)29(27-17)18-8-10-19(11-9-18)41(34,35)36)6-4-5-7-24-26(2,3)22-16-20(42(37,38)39)12-13-23(22)28(24)14-15-40(31,32)33/h4-13,16H,14-15H2,1-3H3,(H,31,32,33)(H,34,35,36)(H,37,38,39)/b5-4+,21-6-,24-7+ |
| InChIKey | LYUSEJBPXXJYIT-FMCNBPECSA-N |
| XLogP | 2.95 |
| TPSA | 199.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.71 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|