C28H32F3N3O2 — CID 76797314
1-(2-ethylhexyl)-2,6-dioxo-4-(trifluoromethyl)-5-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyridine-3-carbonitrile (PubChem CID 76797314) has the molecular formula C28H32F3N3O2 and a molecular weight of 499.58 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-2,6-dioxo-4-(trifluoromethyl)-5-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyridine-3-carbonitrile.
| Compound Name | 1-(2-ethylhexyl)-2,6-dioxo-4-(trifluoromethyl)-5-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 76797314 |
| Molecular Formula | C28H32F3N3O2 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 1-(2-ethylhexyl)-2,6-dioxo-4-(trifluoromethyl)-5-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyridine-3-carbonitrile |
| SMILES | CCCCC(CC)CN1C(=O)C(=CC=C2N(C)c3ccccc3C2(C)C)C(C(F)(F)F)=C(C#N)C1=O |
| InChI | InChI=1S/C28H32F3N3O2/c1-6-8-11-18(7-2)17-34-25(35)19(24(28(29,30)31)20(16-32)26(34)36)14-15-23-27(3,4)21-12-9-10-13-22(21)33(23)5/h9-10,12-15,18H,6-8,11,17H2,1-5H3 |
| InChIKey | WQKQLIRFYXODRS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|