C24H24F3N3O2 — CID 76797282
1-butyl-2,6-dioxo-4-(trifluoromethyl)-5-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyridine-3-carbonitrile (PubChem CID 76797282) has the molecular formula C24H24F3N3O2 and a molecular weight of 443.47 g/mol. Its IUPAC name is 1-butyl-2,6-dioxo-4-(trifluoromethyl)-5-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyridine-3-carbonitrile.
| Compound Name | 1-butyl-2,6-dioxo-4-(trifluoromethyl)-5-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 76797282 |
| Molecular Formula | C24H24F3N3O2 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 1-butyl-2,6-dioxo-4-(trifluoromethyl)-5-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyridine-3-carbonitrile |
| SMILES | CCCCN1C(=O)C(=CC=C2N(C)c3ccccc3C2(C)C)C(C(F)(F)F)=C(C#N)C1=O |
| InChI | InChI=1S/C24H24F3N3O2/c1-5-6-13-30-21(31)15(20(24(25,26)27)16(14-28)22(30)32)11-12-19-23(2,3)17-9-7-8-10-18(17)29(19)4/h7-12H,5-6,13H2,1-4H3 |
| InChIKey | IPLGKQSLDHBWHL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|