C27H22F3N3O2 — CID 59045208
(5Z)-1-benzyl-2,6-dioxo-4-(trifluoromethyl)-5-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyridine-3-carbonitrile (PubChem CID 59045208) has the molecular formula C27H22F3N3O2 and a molecular weight of 477.49 g/mol. Its IUPAC name is (5Z)-1-benzyl-2,6-dioxo-4-(trifluoromethyl)-5-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyridine-3-carbonitrile.
| Compound Name | (5Z)-1-benzyl-2,6-dioxo-4-(trifluoromethyl)-5-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 59045208 |
| Molecular Formula | C27H22F3N3O2 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | (5Z)-1-benzyl-2,6-dioxo-4-(trifluoromethyl)-5-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]pyridine-3-carbonitrile |
| SMILES | CN1C(=C/C=C2\C(=O)N(Cc3ccccc3)C(=O)C(C#N)=C2C(F)(F)F)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C27H22F3N3O2/c1-26(2)20-11-7-8-12-21(20)32(3)22(26)14-13-18-23(27(28,29)30)19(15-31)25(35)33(24(18)34)16-17-9-5-4-6-10-17/h4-14H,16H2,1-3H3/b18-13-,22-14? |
| InChIKey | QCMIMBYMTILLHI-LDNMXAJFSA-N |
| XLogP | 5.18 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|