C31H30F3N3O4 — CID 155248066
4-[(2E)-2-[(2Z)-2-[1-butyl-5-cyano-2,6-dioxo-4-(trifluoromethyl)-3-pyridinylidene]ethylidene]-1,1-dimethylbenzo[e]indol-3-yl]butanoic acid (PubChem CID 155248066) has the molecular formula C31H30F3N3O4 and a molecular weight of 565.59 g/mol. Its IUPAC name is 4-[(2E)-2-[(2Z)-2-[1-butyl-5-cyano-2,6-dioxo-4-(trifluoromethyl)-3-pyridinylidene]ethylidene]-1,1-dimethylbenzo[e]indol-3-yl]butanoic acid.
| Compound Name | 4-[(2E)-2-[(2Z)-2-[1-butyl-5-cyano-2,6-dioxo-4-(trifluoromethyl)-3-pyridinylidene]ethylidene]-1,1-dimethylbenzo[e]indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 155248066 |
| Molecular Formula | C31H30F3N3O4 |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 4-[(2E)-2-[(2Z)-2-[1-butyl-5-cyano-2,6-dioxo-4-(trifluoromethyl)-3-pyridinylidene]ethylidene]-1,1-dimethylbenzo[e]indol-3-yl]butanoic acid |
| SMILES | CCCCN1C(=O)C(C#N)=C(C(F)(F)F)/C(=C/C=C2/N(CCCC(=O)O)c3ccc4ccccc4c3C2(C)C)C1=O |
| InChI | InChI=1S/C31H30F3N3O4/c1-4-5-16-37-28(40)21(26(31(32,33)34)22(18-35)29(37)41)13-15-24-30(2,3)27-20-10-7-6-9-19(20)12-14-23(27)36(24)17-8-11-25(38)39/h6-7,9-10,12-15H,4-5,8,11,16-17H2,1-3H3,(H,38,39)/b21-13-,24-15+ |
| InChIKey | JYTIHZPFNCAUGW-LUOBPUTRSA-N |
| XLogP | 6.16 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|