C55H69N2O2S+ — CID 91446665
6-[2-[2-[3-[2-(1,1-dimethyl-3-pentylbenzo[e]indol-3-ium-2-yl)ethenyl]-2-hexylsulfanylcyclohex-2-en-1-ylidene]ethylidene]-1,1-dimethylbenzo[e]indol-3-yl]hexanoic acid (PubChem CID 91446665) has the molecular formula C55H69N2O2S+ and a molecular weight of 822.24 g/mol. Its IUPAC name is 6-[2-[2-[3-[2-(1,1-dimethyl-3-pentylbenzo[e]indol-3-ium-2-yl)ethenyl]-2-hexylsulfanylcyclohex-2-en-1-ylidene]ethylidene]-1,1-dimethylbenzo[e]indol-3-yl]hexanoic acid.
| Compound Name | 6-[2-[2-[3-[2-(1,1-dimethyl-3-pentylbenzo[e]indol-3-ium-2-yl)ethenyl]-2-hexylsulfanylcyclohex-2-en-1-ylidene]ethylidene]-1,1-dimethylbenzo[e]indol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 91446665 |
| Molecular Formula | C55H69N2O2S+ |
| Molecular Weight | 822.24 g/mol |
| Exact Mass | 821.51 |
| IUPAC Name | 6-[2-[2-[3-[2-(1,1-dimethyl-3-pentylbenzo[e]indol-3-ium-2-yl)ethenyl]-2-hexylsulfanylcyclohex-2-en-1-ylidene]ethylidene]-1,1-dimethylbenzo[e]indol-3-yl]hexanoic acid |
| SMILES | CCCCCCSC1=C(C=CC2=[N+](CCCCC)c3ccc4ccccc4c3C2(C)C)CCCC1=CC=C1N(CCCCCC(=O)O)c2ccc3ccccc3c2C1(C)C |
| InChI | InChI=1S/C55H68N2O2S/c1-7-9-11-20-39-60-53-42(31-35-48-54(3,4)51-44-26-16-14-22-40(44)29-33-46(51)56(48)37-18-10-8-2)24-21-25-43(53)32-36-49-55(5,6)52-45-27-17-15-23-41(45)30-34-47(52)57(49)38-19-12-13-28-50(58)59/h14-17,22-23,26-27,29-36H,7-13,18-21,24-25,28,37-39H2,1-6H3/p+1 |
| InChIKey | DHVKFXOGTNWKJM-UHFFFAOYSA-O |
| XLogP | 15.12 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.24 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|