C14H14N2O3 — CID 70621778
butyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate (PubChem CID 70621778) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is butyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate.
| Compound Name | butyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate |
|---|---|
| PubChem CID | 70621778 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | butyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate |
| SMILES | CCCCOC(=O)/C(C#N)=C1\Nc2ccccc2O1 |
| InChI | InChI=1S/C14H14N2O3/c1-2-3-8-18-14(17)10(9-15)13-16-11-6-4-5-7-12(11)19-13/h4-7,16H,2-3,8H2,1H3/b13-10+ |
| InChIKey | KSBAMXKQVUVVJT-JLHYYAGUSA-N |
| XLogP | 2.57 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|