C13H13N3O2 — CID 3614355
ethyl 2-cyano-2-(3,4-dihydro-1H-quinazolin-2-ylidene)acetate (PubChem CID 3614355) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is ethyl 2-cyano-2-(3,4-dihydro-1H-quinazolin-2-ylidene)acetate.
| Compound Name | ethyl 2-cyano-2-(3,4-dihydro-1H-quinazolin-2-ylidene)acetate |
|---|---|
| PubChem CID | 3614355 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | ethyl 2-cyano-2-(3,4-dihydro-1H-quinazolin-2-ylidene)acetate |
| SMILES | CCOC(=O)C(C#N)=C1NCc2ccccc2N1 |
| InChI | InChI=1S/C13H13N3O2/c1-2-18-13(17)10(7-14)12-15-8-9-5-3-4-6-11(9)16-12/h3-6,15-16H,2,8H2,1H3 |
| InChIKey | PJAUHZFGNVBFDX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|