C8H10N2O2S — CID 24971665
ethyl (2E)-2-cyano-2-(1,3-thiazolidin-2-ylidene)acetate (PubChem CID 24971665) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is ethyl (2E)-2-cyano-2-(1,3-thiazolidin-2-ylidene)acetate.
| Compound Name | ethyl (2E)-2-cyano-2-(1,3-thiazolidin-2-ylidene)acetate |
|---|---|
| PubChem CID | 24971665 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | ethyl (2E)-2-cyano-2-(1,3-thiazolidin-2-ylidene)acetate |
| SMILES | CCOC(=O)/C(C#N)=C1\NCCS1 |
| InChI | InChI=1S/C8H10N2O2S/c1-2-12-8(11)6(5-9)7-10-3-4-13-7/h10H,2-4H2,1H3/b7-6+ |
| InChIKey | QDFPKMKBCYMTFH-VOTSOKGWSA-N |
| XLogP | 0.62 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|