C7H8N2O2S — CID 73202331
methyl 2-cyano-2-(1,3-thiazolidin-2-ylidene)acetate (PubChem CID 73202331) has the molecular formula C7H8N2O2S and a molecular weight of 184.22 g/mol. Its IUPAC name is methyl 2-cyano-2-(1,3-thiazolidin-2-ylidene)acetate.
| Compound Name | methyl 2-cyano-2-(1,3-thiazolidin-2-ylidene)acetate |
|---|---|
| PubChem CID | 73202331 |
| Molecular Formula | C7H8N2O2S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | methyl 2-cyano-2-(1,3-thiazolidin-2-ylidene)acetate |
| SMILES | COC(=O)C(C#N)=C1NCCS1 |
| InChI | InChI=1S/C7H8N2O2S/c1-11-7(10)5(4-8)6-9-2-3-12-6/h9H,2-3H2,1H3 |
| InChIKey | PFGDISKOQDRRLJ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|