C8H9NO2S2 — CID 143189077
methyl (2Z)-2-cyano-2-(4-methyl-1,3-dithiolan-2-ylidene)acetate (PubChem CID 143189077) has the molecular formula C8H9NO2S2 and a molecular weight of 215.30 g/mol. Its IUPAC name is methyl (2Z)-2-cyano-2-(4-methyl-1,3-dithiolan-2-ylidene)acetate.
| Compound Name | methyl (2Z)-2-cyano-2-(4-methyl-1,3-dithiolan-2-ylidene)acetate |
|---|---|
| PubChem CID | 143189077 |
| Molecular Formula | C8H9NO2S2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | methyl (2Z)-2-cyano-2-(4-methyl-1,3-dithiolan-2-ylidene)acetate |
| SMILES | COC(=O)/C(C#N)=C1/SCC(C)S1 |
| InChI | InChI=1S/C8H9NO2S2/c1-5-4-12-8(13-5)6(3-9)7(10)11-2/h5H,4H2,1-2H3/b8-6- |
| InChIKey | ATSYLLGLPRELBD-VURMDHGXSA-N |
| XLogP | 1.76 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|