C13H16N2O6 — CID 14711595
dimethyl (2Z,3R,4R)-2-(1-cyano-2-methoxy-2-oxoethylidene)-1-methylpyrrolidine-3,4-dicarboxylate (PubChem CID 14711595) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is dimethyl (2Z,3R,4R)-2-(1-cyano-2-methoxy-2-oxoethylidene)-1-methylpyrrolidine-3,4-dicarboxylate.
| Compound Name | dimethyl (2Z,3R,4R)-2-(1-cyano-2-methoxy-2-oxoethylidene)-1-methylpyrrolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 14711595 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | dimethyl (2Z,3R,4R)-2-(1-cyano-2-methoxy-2-oxoethylidene)-1-methylpyrrolidine-3,4-dicarboxylate |
| SMILES | COC(=O)/C(C#N)=C1/[C@H](C(=O)OC)[C@@H](C(=O)OC)CN1C |
| InChI | InChI=1S/C13H16N2O6/c1-15-6-8(12(17)20-3)9(13(18)21-4)10(15)7(5-14)11(16)19-2/h8-9H,6H2,1-4H3/b10-7-/t8-,9+/m0/s1 |
| InChIKey | MBBACILILXHVHT-WQHZVDDGSA-N |
| XLogP | -0.54 |
| TPSA | 105.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|