C10H12N2O5 — CID 134921326
ethyl (2Z)-2-(1-cyano-2-methoxy-2-oxoethylidene)-1,3-oxazolidine-4-carboxylate (PubChem CID 134921326) has the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. Its IUPAC name is ethyl (2Z)-2-(1-cyano-2-methoxy-2-oxoethylidene)-1,3-oxazolidine-4-carboxylate.
| Compound Name | ethyl (2Z)-2-(1-cyano-2-methoxy-2-oxoethylidene)-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 134921326 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | ethyl (2Z)-2-(1-cyano-2-methoxy-2-oxoethylidene)-1,3-oxazolidine-4-carboxylate |
| SMILES | CCOC(=O)C1CO/C(=C(/C#N)C(=O)OC)N1 |
| InChI | InChI=1S/C10H12N2O5/c1-3-16-10(14)7-5-17-8(12-7)6(4-11)9(13)15-2/h7,12H,3,5H2,1-2H3/b8-6- |
| InChIKey | JWLJFZOTGNFNDY-VURMDHGXSA-N |
| XLogP | -0.55 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|