C11H14N2O5 — CID 3004324
ethyl (2Z)-2-(1-cyano-2-ethoxy-2-oxoethylidene)-1,3-oxazolidine-4-carboxylate (PubChem CID 3004324) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is ethyl (2Z)-2-(1-cyano-2-ethoxy-2-oxoethylidene)-1,3-oxazolidine-4-carboxylate.
| Compound Name | ethyl (2Z)-2-(1-cyano-2-ethoxy-2-oxoethylidene)-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 3004324 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | ethyl (2Z)-2-(1-cyano-2-ethoxy-2-oxoethylidene)-1,3-oxazolidine-4-carboxylate |
| SMILES | CCOC(=O)/C(C#N)=C1/NC(C(=O)OCC)CO1 |
| InChI | InChI=1S/C11H14N2O5/c1-3-16-10(14)7(5-12)9-13-8(6-18-9)11(15)17-4-2/h8,13H,3-4,6H2,1-2H3/b9-7- |
| InChIKey | SABCFEKSIXKNFG-CLFYSBASSA-N |
| XLogP | -0.16 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|