C16H16N2O3S — CID 51414173
methyl (2E)-2-cyano-2-[(1S,5R,6R)-3-cyano-6-methyl-2-methylsulfanyl-4-oxo-9-bicyclo[3.3.1]non-2-enylidene]acetate (PubChem CID 51414173) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is methyl (2E)-2-cyano-2-[(1S,5R,6R)-3-cyano-6-methyl-2-methylsulfanyl-4-oxo-9-bicyclo[3.3.1]non-2-enylidene]acetate.
| Compound Name | methyl (2E)-2-cyano-2-[(1S,5R,6R)-3-cyano-6-methyl-2-methylsulfanyl-4-oxo-9-bicyclo[3.3.1]non-2-enylidene]acetate |
|---|---|
| PubChem CID | 51414173 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | methyl (2E)-2-cyano-2-[(1S,5R,6R)-3-cyano-6-methyl-2-methylsulfanyl-4-oxo-9-bicyclo[3.3.1]non-2-enylidene]acetate |
| SMILES | COC(=O)/C(C#N)=C1/[C@@H]2CC[C@@H](C)[C@H]1C(=O)C(C#N)=C2SC |
| InChI | InChI=1S/C16H16N2O3S/c1-8-4-5-9-13(10(6-17)16(20)21-2)12(8)14(19)11(7-18)15(9)22-3/h8-9,12H,4-5H2,1-3H3/b13-10-/t8-,9+,12-/m1/s1 |
| InChIKey | VTNUUNLCRFINGS-BLSZMDOFSA-N |
| XLogP | 2.37 |
| TPSA | 90.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|