C6H7N3OS — CID 124849651
(2Z)-2-cyano-2-(1,3-thiazolidin-2-ylidene)acetamide (PubChem CID 124849651) has the molecular formula C6H7N3OS and a molecular weight of 169.21 g/mol. Its IUPAC name is (2Z)-2-cyano-2-(1,3-thiazolidin-2-ylidene)acetamide.
| Compound Name | (2Z)-2-cyano-2-(1,3-thiazolidin-2-ylidene)acetamide |
|---|---|
| PubChem CID | 124849651 |
| Molecular Formula | C6H7N3OS |
| Molecular Weight | 169.21 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | (2Z)-2-cyano-2-(1,3-thiazolidin-2-ylidene)acetamide |
| SMILES | N#C/C(C(N)=O)=C1\NCCS1 |
| InChI | InChI=1S/C6H7N3OS/c7-3-4(5(8)10)6-9-1-2-11-6/h9H,1-2H2,(H2,8,10)/b6-4- |
| InChIKey | PDVUUIVZOAMWAT-XQRVVYSFSA-N |
| XLogP | -0.46 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.21 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|