C12H10N2O4S2 — CID 5474932
(4E)-4-(2-amino-1-cyano-2-oxoethylidene)-2,3-dihydrothiochromene-6-sulfonic acid (PubChem CID 5474932) has the molecular formula C12H10N2O4S2 and a molecular weight of 310.36 g/mol. Its IUPAC name is (4E)-4-(2-amino-1-cyano-2-oxoethylidene)-2,3-dihydrothiochromene-6-sulfonic acid.
| Compound Name | (4E)-4-(2-amino-1-cyano-2-oxoethylidene)-2,3-dihydrothiochromene-6-sulfonic acid |
|---|---|
| PubChem CID | 5474932 |
| Molecular Formula | C12H10N2O4S2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | (4E)-4-(2-amino-1-cyano-2-oxoethylidene)-2,3-dihydrothiochromene-6-sulfonic acid |
| SMILES | N#C/C(C(N)=O)=C1/CCSc2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C12H10N2O4S2/c13-6-10(12(14)15)8-3-4-19-11-2-1-7(5-9(8)11)20(16,17)18/h1-2,5H,3-4H2,(H2,14,15)(H,16,17,18)/b10-8+ |
| InChIKey | UZNGGGRAMAROTI-CSKARUKUSA-N |
| XLogP | 1.19 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|