About (2Z)-2-cyano-2-(1,7-dihydropurin-6-ylidene)acetamide
(2Z)-2-cyano-2-(1,7-dihydropurin-6-ylidene)acetamide (PubChem CID 13486102) has the molecular formula C8H6N6O
and a molecular weight of 202.18 g/mol. Its IUPAC name is (2Z)-2-cyano-2-(1,7-dihydropurin-6-ylidene)acetamide.
Molecular Properties
| Compound Name | (2Z)-2-cyano-2-(1,7-dihydropurin-6-ylidene)acetamide |
| PubChem CID | 13486102 |
| Molecular Formula | C8H6N6O |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | (2Z)-2-cyano-2-(1,7-dihydropurin-6-ylidene)acetamide |
| SMILES | N#C/C(C(N)=O)=C1/NC=Nc2nc[nH]c21 |
| InChI | InChI=1S/C8H6N6O/c9-1-4(7(10)15)5-6-8(13-2-11-5)14-3-12-6/h2-3H,(H2,10,15)(H,11,13)(H,12,14)/b5-4- |
| InChIKey | DKVUQZWCOIZJIT-PLNGDYQASA-N |
| XLogP | -0.61 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-cyano-2-(1,7-dihydropurin-6-ylidene)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-cyano-2-(1,7-dihydropurin-6-ylidene)acetamide?
The IUPAC name of (2Z)-2-cyano-2-(1,7-dihydropurin-6-ylidene)acetamide (CID 13486102) is (2Z)-2-cyano-2-(1,7-dihydropurin-6-ylidene)acetamide.
What is the SMILES notation for (2Z)-2-cyano-2-(1,7-dihydropurin-6-ylidene)acetamide?
The canonical SMILES for (2Z)-2-cyano-2-(1,7-dihydropurin-6-ylidene)acetamide is N#C/C(C(N)=O)=C1/NC=Nc2nc[nH]c21.
What is the InChIKey of (2Z)-2-cyano-2-(1,7-dihydropurin-6-ylidene)acetamide?
The InChIKey is DKVUQZWCOIZJIT-PLNGDYQASA-N. The full InChI is InChI=1S/C8H6N6O/c9-1-4(7(10)15)5-6-8(13-2-11-5)14-3-12-6/h2-3H,(H2,10,15)(H,11,13)(H,12,14)/b5-4-.
What are the key properties of (2Z)-2-cyano-2-(1,7-dihydropurin-6-ylidene)acetamide?
(2Z)-2-cyano-2-(1,7-dihydropurin-6-ylidene)acetamide has a molecular weight of 202.18 g/mol, XLogP of -0.61, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-cyano-2-(1,7-dihydropurin-6-ylidene)acetamide is sourced from PubChem (CID 13486102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).