C9H9N3O2 — CID 12910401
ethyl (2E)-2-cyano-2-(1H-pyrimidin-6-ylidene)acetate (PubChem CID 12910401) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is ethyl (2E)-2-cyano-2-(1H-pyrimidin-6-ylidene)acetate.
| Compound Name | ethyl (2E)-2-cyano-2-(1H-pyrimidin-6-ylidene)acetate |
|---|---|
| PubChem CID | 12910401 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | ethyl (2E)-2-cyano-2-(1H-pyrimidin-6-ylidene)acetate |
| SMILES | CCOC(=O)/C(C#N)=C1\C=CN=CN1 |
| InChI | InChI=1S/C9H9N3O2/c1-2-14-9(13)7(5-10)8-3-4-11-6-12-8/h3-4,6H,2H2,1H3,(H,11,12)/b8-7+ |
| InChIKey | RSIPYGWHCBLYMU-BQYQJAHWSA-N |
| XLogP | 0.47 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|