C13H11N3O2 — CID 171134045
ethyl 2-cyano-2-(1H-quinazolin-4-ylidene)acetate (PubChem CID 171134045) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is ethyl 2-cyano-2-(1H-quinazolin-4-ylidene)acetate.
| Compound Name | ethyl 2-cyano-2-(1H-quinazolin-4-ylidene)acetate |
|---|---|
| PubChem CID | 171134045 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | ethyl 2-cyano-2-(1H-quinazolin-4-ylidene)acetate |
| SMILES | CCOC(=O)C(C#N)=C1N=CNc2ccccc21 |
| InChI | InChI=1S/C13H11N3O2/c1-2-18-13(17)10(7-14)12-9-5-3-4-6-11(9)15-8-16-12/h3-6,8H,2H2,1H3,(H,15,16) |
| InChIKey | JSIWMFJHZXWWSL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|