C17H12N4O5 — CID 164995154
ethyl (2Z)-2-cyano-2-[3-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)isoindol-1-ylidene]acetate (PubChem CID 164995154) has the molecular formula C17H12N4O5 and a molecular weight of 352.31 g/mol. Its IUPAC name is ethyl (2Z)-2-cyano-2-[3-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)isoindol-1-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-cyano-2-[3-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)isoindol-1-ylidene]acetate |
|---|---|
| PubChem CID | 164995154 |
| Molecular Formula | C17H12N4O5 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | ethyl (2Z)-2-cyano-2-[3-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)isoindol-1-ylidene]acetate |
| SMILES | CCOC(=O)/C(C#N)=C1\N=C(c2c(O)[nH]c(=O)[nH]c2=O)c2ccccc21 |
| InChI | InChI=1S/C17H12N4O5/c1-2-26-16(24)10(7-18)12-8-5-3-4-6-9(8)13(19-12)11-14(22)20-17(25)21-15(11)23/h3-6H,2H2,1H3,(H3,20,21,22,23,25)/b12-10- |
| InChIKey | UVTDJGVISGIODT-BENRWUELSA-N |
| XLogP | 0.42 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|