C15H13N3O3 — CID 110209112
ethyl 2-cyano-2-[4-(2-hydroxyphenyl)-1H-pyrimidin-6-ylidene]acetate (PubChem CID 110209112) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is ethyl 2-cyano-2-[4-(2-hydroxyphenyl)-1H-pyrimidin-6-ylidene]acetate.
| Compound Name | ethyl 2-cyano-2-[4-(2-hydroxyphenyl)-1H-pyrimidin-6-ylidene]acetate |
|---|---|
| PubChem CID | 110209112 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | ethyl 2-cyano-2-[4-(2-hydroxyphenyl)-1H-pyrimidin-6-ylidene]acetate |
| SMILES | CCOC(=O)C(C#N)=C1C=C(c2ccccc2O)N=CN1 |
| InChI | InChI=1S/C15H13N3O3/c1-2-21-15(20)11(8-16)13-7-12(17-9-18-13)10-5-3-4-6-14(10)19/h3-7,9,19H,2H2,1H3,(H,17,18) |
| InChIKey | JGBBIRJHHIXAKQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|