C12H10N2O2S — CID 78385752
ethyl 2-(3H-1,3-benzothiazol-2-ylidene)-2-cyanoacetate (PubChem CID 78385752) has the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. Its IUPAC name is ethyl 2-(3H-1,3-benzothiazol-2-ylidene)-2-cyanoacetate.
| Compound Name | ethyl 2-(3H-1,3-benzothiazol-2-ylidene)-2-cyanoacetate |
|---|---|
| PubChem CID | 78385752 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | ethyl 2-(3H-1,3-benzothiazol-2-ylidene)-2-cyanoacetate |
| SMILES | CCOC(=O)C(C#N)=C1Nc2ccccc2S1 |
| InChI | InChI=1S/C12H10N2O2S/c1-2-16-12(15)8(7-13)11-14-9-5-3-4-6-10(9)17-11/h3-6,14H,2H2,1H3 |
| InChIKey | GUADRVGYRODSBA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|