C24H24N4O4S4 — CID 159986678
2-aminobenzenethiol;methyl (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-cyanoacetate;methyl 2-cyano-3,3-bis(methylsulfanyl)prop-2-enoate (PubChem CID 159986678) has the molecular formula C24H24N4O4S4 and a molecular weight of 560.75 g/mol. Its IUPAC name is 2-aminobenzenethiol;methyl (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-cyanoacetate;methyl 2-cyano-3,3-bis(methylsulfanyl)prop-2-enoate.
| Compound Name | 2-aminobenzenethiol;methyl (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-cyanoacetate;methyl 2-cyano-3,3-bis(methylsulfanyl)prop-2-enoate |
|---|---|
| PubChem CID | 159986678 |
| Molecular Formula | C24H24N4O4S4 |
| Molecular Weight | 560.75 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | 2-aminobenzenethiol;methyl (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-cyanoacetate;methyl 2-cyano-3,3-bis(methylsulfanyl)prop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C1/Nc2ccccc2S1.COC(=O)C(C#N)=C(SC)SC.Nc1ccccc1S |
| InChI | InChI=1S/C11H8N2O2S.C7H9NO2S2.C6H7NS/c1-15-11(14)7(6-12)10-13-8-4-2-3-5-9(8)16-10;1-10-6(9)5(4-8)7(11-2)12-3;7-5-3-1-2-4-6(5)8/h2-5,13H,1H3;1-3H3;1-4,8H,7H2/b10-7-;; |
| InChIKey | OGKQOHPLJYBFDY-QISVCDMNSA-N |
| XLogP | 5.29 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.75 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|