C11H7NO3S — CID 22978657
methyl (2Z)-2-(1,3-benzoxathiol-2-ylidene)-2-cyanoacetate (PubChem CID 22978657) has the molecular formula C11H7NO3S and a molecular weight of 233.25 g/mol. Its IUPAC name is methyl (2Z)-2-(1,3-benzoxathiol-2-ylidene)-2-cyanoacetate.
| Compound Name | methyl (2Z)-2-(1,3-benzoxathiol-2-ylidene)-2-cyanoacetate |
|---|---|
| PubChem CID | 22978657 |
| Molecular Formula | C11H7NO3S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | methyl (2Z)-2-(1,3-benzoxathiol-2-ylidene)-2-cyanoacetate |
| SMILES | COC(=O)/C(C#N)=C1/Oc2ccccc2S1 |
| InChI | InChI=1S/C11H7NO3S/c1-14-10(13)7(6-12)11-15-8-4-2-3-5-9(8)16-11/h2-5H,1H3/b11-7- |
| InChIKey | IOBRRWCXBHSAMS-XFFZJAGNSA-N |
| XLogP | 2.08 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|