C17H12ClN3S2 — CID 6098146
(2E)-2-(3H-1,3-benzothiazol-2-ylidene)-N-(3-chloro-2-methylphenyl)-2-cyanoethanethioamide (PubChem CID 6098146) has the molecular formula C17H12ClN3S2 and a molecular weight of 357.89 g/mol. Its IUPAC name is (2E)-2-(3H-1,3-benzothiazol-2-ylidene)-N-(3-chloro-2-methylphenyl)-2-cyanoethanethioamide.
| Compound Name | (2E)-2-(3H-1,3-benzothiazol-2-ylidene)-N-(3-chloro-2-methylphenyl)-2-cyanoethanethioamide |
|---|---|
| PubChem CID | 6098146 |
| Molecular Formula | C17H12ClN3S2 |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | (2E)-2-(3H-1,3-benzothiazol-2-ylidene)-N-(3-chloro-2-methylphenyl)-2-cyanoethanethioamide |
| SMILES | Cc1c(Cl)cccc1NC(=S)/C(C#N)=C1\Nc2ccccc2S1 |
| InChI | InChI=1S/C17H12ClN3S2/c1-10-12(18)5-4-7-13(10)20-16(22)11(9-19)17-21-14-6-2-3-8-15(14)23-17/h2-8,21H,1H3,(H,20,22)/b17-11+ |
| InChIKey | QWOGNPBEMFQPQM-GZTJUZNOSA-N |
| XLogP | 5.34 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|