4-amino-1H-imidazole-5-carboxamide;molecular hydrogen

C4H14N4O — CID 161460316

IUPAC4-amino-1H-imidazole-5-carboxamide;molecular hydrogen
SMILESNC(=O)c1[nH]cnc1N.[H][H].[H][H].[H][H].[H][H]
InChIInChI=1S/C4H6N4O.4H2/c5-3-2(4(6)9)7-1-8-3;;;;/h1H,5H2,(H2,6,9)(H,7,8);4*1H
InChIKeyWBSAIIILAUIKPL-UHFFFAOYSA-N
MW134.18 g/mol
LogP0.07
Rot. Bonds1

About 4-amino-1H-imidazole-5-carboxamide;molecular hydrogen

4-amino-1H-imidazole-5-carboxamide;molecular hydrogen (PubChem CID 161460316) has the molecular formula C4H14N4O and a molecular weight of 134.18 g/mol. Its IUPAC name is 4-amino-1H-imidazole-5-carboxamide;molecular hydrogen.

Molecular Properties

Compound Name4-amino-1H-imidazole-5-carboxamide;molecular hydrogen
PubChem CID161460316
Molecular FormulaC4H14N4O
Molecular Weight134.18 g/mol
Exact Mass134.12
IUPAC Name4-amino-1H-imidazole-5-carboxamide;molecular hydrogen
SMILESNC(=O)c1[nH]cnc1N.[H][H].[H][H].[H][H].[H][H]
InChIInChI=1S/C4H6N4O.4H2/c5-3-2(4(6)9)7-1-8-3;;;;/h1H,5H2,(H2,6,9)(H,7,8);4*1H
InChIKeyWBSAIIILAUIKPL-UHFFFAOYSA-N
XLogP0.07
TPSA97.79 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500134.18
LogP ≤ 50.07
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-amino-1H-imidazole-5-carboxamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-1H-imidazole-5-carboxamide;molecular hydrogen?
The IUPAC name of 4-amino-1H-imidazole-5-carboxamide;molecular hydrogen (CID 161460316) is 4-amino-1H-imidazole-5-carboxamide;molecular hydrogen.
What is the SMILES notation for 4-amino-1H-imidazole-5-carboxamide;molecular hydrogen?
The canonical SMILES for 4-amino-1H-imidazole-5-carboxamide;molecular hydrogen is NC(=O)c1[nH]cnc1N.[H][H].[H][H].[H][H].[H][H].
What is the InChIKey of 4-amino-1H-imidazole-5-carboxamide;molecular hydrogen?
The InChIKey is WBSAIIILAUIKPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O.4H2/c5-3-2(4(6)9)7-1-8-3;;;;/h1H,5H2,(H2,6,9)(H,7,8);4*1H.
What are the key properties of 4-amino-1H-imidazole-5-carboxamide;molecular hydrogen?
4-amino-1H-imidazole-5-carboxamide;molecular hydrogen has a molecular weight of 134.18 g/mol, XLogP of 0.07, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1H-imidazole-5-carboxamide;molecular hydrogen is sourced from PubChem (CID 161460316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).