C7H7N3O3 — CID 70553499
(5-carbamoyl-1H-imidazol-4-yl) prop-2-enoate (PubChem CID 70553499) has the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. Its IUPAC name is (5-carbamoyl-1H-imidazol-4-yl) prop-2-enoate.
| Compound Name | (5-carbamoyl-1H-imidazol-4-yl) prop-2-enoate |
|---|---|
| PubChem CID | 70553499 |
| Molecular Formula | C7H7N3O3 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | (5-carbamoyl-1H-imidazol-4-yl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1nc[nH]c1C(N)=O |
| InChI | InChI=1S/C7H7N3O3/c1-2-4(11)13-7-5(6(8)12)9-3-10-7/h2-3H,1H2,(H2,8,12)(H,9,10) |
| InChIKey | GGELIYLXRMWHJF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|