About 4-amino-N'-methoxy-1H-imidazole-5-carboximidamide
4-amino-N'-methoxy-1H-imidazole-5-carboximidamide (PubChem CID 135992594) has the molecular formula C5H9N5O
and a molecular weight of 155.16 g/mol. Its IUPAC name is 4-amino-N'-methoxy-1H-imidazole-5-carboximidamide.
Molecular Properties
| Compound Name | 4-amino-N'-methoxy-1H-imidazole-5-carboximidamide |
| PubChem CID | 135992594 |
| Molecular Formula | C5H9N5O |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 4-amino-N'-methoxy-1H-imidazole-5-carboximidamide |
| SMILES | CON=C(N)c1[nH]cnc1N |
| InChI | InChI=1S/C5H9N5O/c1-11-10-5(7)3-4(6)9-2-8-3/h2H,6H2,1H3,(H2,7,10)(H,8,9) |
| InChIKey | BKGBFZBRNLRGFV-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N'-methoxy-1H-imidazole-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N'-methoxy-1H-imidazole-5-carboximidamide?
The IUPAC name of 4-amino-N'-methoxy-1H-imidazole-5-carboximidamide (CID 135992594) is 4-amino-N'-methoxy-1H-imidazole-5-carboximidamide.
What is the SMILES notation for 4-amino-N'-methoxy-1H-imidazole-5-carboximidamide?
The canonical SMILES for 4-amino-N'-methoxy-1H-imidazole-5-carboximidamide is CON=C(N)c1[nH]cnc1N.
What is the InChIKey of 4-amino-N'-methoxy-1H-imidazole-5-carboximidamide?
The InChIKey is BKGBFZBRNLRGFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5O/c1-11-10-5(7)3-4(6)9-2-8-3/h2H,6H2,1H3,(H2,7,10)(H,8,9).
What are the key properties of 4-amino-N'-methoxy-1H-imidazole-5-carboximidamide?
4-amino-N'-methoxy-1H-imidazole-5-carboximidamide has a molecular weight of 155.16 g/mol, XLogP of -0.74, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N'-methoxy-1H-imidazole-5-carboximidamide is sourced from PubChem (CID 135992594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).