C4H8N6 — CID 139592585
N',4-diamino-1H-imidazole-5-carboximidamide (PubChem CID 139592585) has the molecular formula C4H8N6 and a molecular weight of 140.15 g/mol. Its IUPAC name is N',4-diamino-1H-imidazole-5-carboximidamide.
| Compound Name | N',4-diamino-1H-imidazole-5-carboximidamide |
|---|---|
| PubChem CID | 139592585 |
| Molecular Formula | C4H8N6 |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | N',4-diamino-1H-imidazole-5-carboximidamide |
| SMILES | NN=C(N)c1[nH]cnc1N |
| InChI | InChI=1S/C4H8N6/c5-3-2(4(6)10-7)8-1-9-3/h1H,5,7H2,(H2,6,10)(H,8,9) |
| InChIKey | KXVOBKZMBRUXGJ-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 119.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|