C14H16ClN3O3 — CID 124928034
ethyl (2E)-2-(7-chloro-3,4-dihydro-1H-quinazolin-2-ylidene)-3-(methylamino)-3-oxopropanoate (PubChem CID 124928034) has the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. Its IUPAC name is ethyl (2E)-2-(7-chloro-3,4-dihydro-1H-quinazolin-2-ylidene)-3-(methylamino)-3-oxopropanoate.
| Compound Name | ethyl (2E)-2-(7-chloro-3,4-dihydro-1H-quinazolin-2-ylidene)-3-(methylamino)-3-oxopropanoate |
|---|---|
| PubChem CID | 124928034 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | ethyl (2E)-2-(7-chloro-3,4-dihydro-1H-quinazolin-2-ylidene)-3-(methylamino)-3-oxopropanoate |
| SMILES | CCOC(=O)/C(C(=O)NC)=C1\NCc2ccc(Cl)cc2N1 |
| InChI | InChI=1S/C14H16ClN3O3/c1-3-21-14(20)11(13(19)16-2)12-17-7-8-4-5-9(15)6-10(8)18-12/h4-6,17-18H,3,7H2,1-2H3,(H,16,19)/b12-11+ |
| InChIKey | VPVKUXYUXYFEIP-VAWYXSNFSA-N |
| XLogP | 1.38 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|