C16H14ClNO6 — CID 71483490
diethyl (2E)-2-(5-chloro-2-oxo-1H-indol-3-ylidene)-3-oxobutanedioate (PubChem CID 71483490) has the molecular formula C16H14ClNO6 and a molecular weight of 351.74 g/mol. Its IUPAC name is diethyl (2E)-2-(5-chloro-2-oxo-1H-indol-3-ylidene)-3-oxobutanedioate.
| Compound Name | diethyl (2E)-2-(5-chloro-2-oxo-1H-indol-3-ylidene)-3-oxobutanedioate |
|---|---|
| PubChem CID | 71483490 |
| Molecular Formula | C16H14ClNO6 |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | diethyl (2E)-2-(5-chloro-2-oxo-1H-indol-3-ylidene)-3-oxobutanedioate |
| SMILES | CCOC(=O)C(=O)/C(C(=O)OCC)=C1\C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H14ClNO6/c1-3-23-15(21)12(13(19)16(22)24-4-2)11-9-7-8(17)5-6-10(9)18-14(11)20/h5-7H,3-4H2,1-2H3,(H,18,20)/b12-11+ |
| InChIKey | MDANFASZFYWWBM-VAWYXSNFSA-N |
| XLogP | 1.74 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|