C12H12ClNO3S — CID 10541162
ethyl 7-chloro-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxylate (PubChem CID 10541162) has the molecular formula C12H12ClNO3S and a molecular weight of 285.75 g/mol. Its IUPAC name is ethyl 7-chloro-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxylate.
| Compound Name | ethyl 7-chloro-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxylate |
|---|---|
| PubChem CID | 10541162 |
| Molecular Formula | C12H12ClNO3S |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | ethyl 7-chloro-2-methyl-3-oxo-4H-1,4-benzothiazine-2-carboxylate |
| SMILES | CCOC(=O)C1(C)Sc2cc(Cl)ccc2NC1=O |
| InChI | InChI=1S/C12H12ClNO3S/c1-3-17-11(16)12(2)10(15)14-8-5-4-7(13)6-9(8)18-12/h4-6H,3H2,1-2H3,(H,14,15) |
| InChIKey | PQVGHJDUTMYPDG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|