C13H14BrNO3 — CID 59778158
ethyl 6-bromo-3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylate (PubChem CID 59778158) has the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. Its IUPAC name is ethyl 6-bromo-3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylate.
| Compound Name | ethyl 6-bromo-3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 59778158 |
| Molecular Formula | C13H14BrNO3 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | ethyl 6-bromo-3-methyl-2-oxo-1,4-dihydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1(C)Cc2cc(Br)ccc2NC1=O |
| InChI | InChI=1S/C13H14BrNO3/c1-3-18-12(17)13(2)7-8-6-9(14)4-5-10(8)15-11(13)16/h4-6H,3,7H2,1-2H3,(H,15,16) |
| InChIKey | BQOQWRGHWDSZOH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|