C14H17N3O3 — CID 67937685
ethyl 2,7-dimethyl-6-oxo-1,2,3,5-tetrahydropyrrolo[2,3-f]benzimidazole-7-carboxylate (PubChem CID 67937685) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is ethyl 2,7-dimethyl-6-oxo-1,2,3,5-tetrahydropyrrolo[2,3-f]benzimidazole-7-carboxylate.
| Compound Name | ethyl 2,7-dimethyl-6-oxo-1,2,3,5-tetrahydropyrrolo[2,3-f]benzimidazole-7-carboxylate |
|---|---|
| PubChem CID | 67937685 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | ethyl 2,7-dimethyl-6-oxo-1,2,3,5-tetrahydropyrrolo[2,3-f]benzimidazole-7-carboxylate |
| SMILES | CCOC(=O)C1(C)C(=O)Nc2cc3c(cc21)NC(C)N3 |
| InChI | InChI=1S/C14H17N3O3/c1-4-20-13(19)14(3)8-5-10-11(16-7(2)15-10)6-9(8)17-12(14)18/h5-7,15-16H,4H2,1-3H3,(H,17,18) |
| InChIKey | TYYXOGDAGUQNQN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|