C22H25N3O7S — CID 88601374
ethyl 7-ethyl-2-(2-methoxy-4-methylsulfonyloxyphenyl)-6-oxo-1,2,3,5-tetrahydropyrrolo[2,3-f]benzimidazole-7-carboxylate (PubChem CID 88601374) has the molecular formula C22H25N3O7S and a molecular weight of 475.52 g/mol. Its IUPAC name is ethyl 7-ethyl-2-(2-methoxy-4-methylsulfonyloxyphenyl)-6-oxo-1,2,3,5-tetrahydropyrrolo[2,3-f]benzimidazole-7-carboxylate.
| Compound Name | ethyl 7-ethyl-2-(2-methoxy-4-methylsulfonyloxyphenyl)-6-oxo-1,2,3,5-tetrahydropyrrolo[2,3-f]benzimidazole-7-carboxylate |
|---|---|
| PubChem CID | 88601374 |
| Molecular Formula | C22H25N3O7S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | ethyl 7-ethyl-2-(2-methoxy-4-methylsulfonyloxyphenyl)-6-oxo-1,2,3,5-tetrahydropyrrolo[2,3-f]benzimidazole-7-carboxylate |
| SMILES | CCOC(=O)C1(CC)C(=O)Nc2cc3c(cc21)NC(c1ccc(OS(C)(=O)=O)cc1OC)N3 |
| InChI | InChI=1S/C22H25N3O7S/c1-5-22(21(27)31-6-2)14-10-16-17(11-15(14)25-20(22)26)24-19(23-16)13-8-7-12(9-18(13)30-3)32-33(4,28)29/h7-11,19,23-24H,5-6H2,1-4H3,(H,25,26) |
| InChIKey | TXIPPFAQUNKSFO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|