C13H15NO6 — CID 699772
ethyl (3S)-3-hydroxy-4,6-dimethoxy-2-oxo-1H-indole-3-carboxylate (PubChem CID 699772) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is ethyl (3S)-3-hydroxy-4,6-dimethoxy-2-oxo-1H-indole-3-carboxylate.
| Compound Name | ethyl (3S)-3-hydroxy-4,6-dimethoxy-2-oxo-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 699772 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | ethyl (3S)-3-hydroxy-4,6-dimethoxy-2-oxo-1H-indole-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(O)C(=O)Nc2cc(OC)cc(OC)c21 |
| InChI | InChI=1S/C13H15NO6/c1-4-20-12(16)13(17)10-8(14-11(13)15)5-7(18-2)6-9(10)19-3/h5-6,17H,4H2,1-3H3,(H,14,15)/t13-/m0/s1 |
| InChIKey | PCCZQYRIWLXVNZ-ZDUSSCGKSA-N |
| XLogP | 0.41 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|