C23H19ClN2O4S2 — CID 75769219
ethyl 4-(4-chlorophenyl)-2-[(2-methyl-3-oxo-4H-1,4-benzothiazine-2-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 75769219) has the molecular formula C23H19ClN2O4S2 and a molecular weight of 487.00 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-2-[(2-methyl-3-oxo-4H-1,4-benzothiazine-2-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-2-[(2-methyl-3-oxo-4H-1,4-benzothiazine-2-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 75769219 |
| Molecular Formula | C23H19ClN2O4S2 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-2-[(2-methyl-3-oxo-4H-1,4-benzothiazine-2-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)C1(C)Sc2ccccc2NC1=O |
| InChI | InChI=1S/C23H19ClN2O4S2/c1-3-30-20(27)18-15(13-8-10-14(24)11-9-13)12-31-19(18)26-22(29)23(2)21(28)25-16-6-4-5-7-17(16)32-23/h4-12H,3H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | WTTRXLUHLGVPIA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|