C23H19ClN2O5S — CID 75769601
ethyl 4-(4-chlorophenyl)-2-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]thiophene-3-carboxylate (PubChem CID 75769601) has the molecular formula C23H19ClN2O5S and a molecular weight of 470.93 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-2-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-2-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 75769601 |
| Molecular Formula | C23H19ClN2O5S |
| Molecular Weight | 470.93 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-2-[[2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)CC1Oc2ccccc2NC1=O |
| InChI | InChI=1S/C23H19ClN2O5S/c1-2-30-23(29)20-15(13-7-9-14(24)10-8-13)12-32-22(20)26-19(27)11-18-21(28)25-16-5-3-4-6-17(16)31-18/h3-10,12,18H,2,11H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | DLEZLEAXDBVSEN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.93 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|