C26H20ClNO5S — CID 177464224
(3Z)-5-chloro-3-[2-(4-methoxyphenyl)-1-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-2-oxoethylidene]-1H-indol-2-one (PubChem CID 177464224) has the molecular formula C26H20ClNO5S and a molecular weight of 493.97 g/mol. Its IUPAC name is (3Z)-5-chloro-3-[2-(4-methoxyphenyl)-1-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-2-oxoethylidene]-1H-indol-2-one.
| Compound Name | (3Z)-5-chloro-3-[2-(4-methoxyphenyl)-1-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-2-oxoethylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 177464224 |
| Molecular Formula | C26H20ClNO5S |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | (3Z)-5-chloro-3-[2-(4-methoxyphenyl)-1-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-2-oxoethylidene]-1H-indol-2-one |
| SMILES | COc1ccc(C(=O)CS/C(C(=O)c2ccc(OC)cc2)=C2\C(=O)Nc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C26H20ClNO5S/c1-32-18-8-3-15(4-9-18)22(29)14-34-25(24(30)16-5-10-19(33-2)11-6-16)23-20-13-17(27)7-12-21(20)28-26(23)31/h3-13H,14H2,1-2H3,(H,28,31)/b25-23- |
| InChIKey | AZBYJHLTNXOXQP-BZZOAKBMSA-N |
| XLogP | 5.52 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|