C26H21NO5S — CID 177392701
(3Z)-3-[2-(4-methoxyphenyl)-1-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-2-oxoethylidene]-1H-indol-2-one (PubChem CID 177392701) has the molecular formula C26H21NO5S and a molecular weight of 459.52 g/mol. Its IUPAC name is (3Z)-3-[2-(4-methoxyphenyl)-1-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-2-oxoethylidene]-1H-indol-2-one.
| Compound Name | (3Z)-3-[2-(4-methoxyphenyl)-1-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-2-oxoethylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 177392701 |
| Molecular Formula | C26H21NO5S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | (3Z)-3-[2-(4-methoxyphenyl)-1-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-2-oxoethylidene]-1H-indol-2-one |
| SMILES | COc1ccc(C(=O)CS/C(C(=O)c2ccc(OC)cc2)=C2\C(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C26H21NO5S/c1-31-18-11-7-16(8-12-18)22(28)15-33-25(24(29)17-9-13-19(32-2)14-10-17)23-20-5-3-4-6-21(20)27-26(23)30/h3-14H,15H2,1-2H3,(H,27,30)/b25-23- |
| InChIKey | YYBRMUZVRZGMFF-BZZOAKBMSA-N |
| XLogP | 4.87 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|