C21H14Cl2N2O4S3 — CID 54753874
5-[bis[[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 54753874) has the molecular formula C21H14Cl2N2O4S3 and a molecular weight of 525.46 g/mol. Its IUPAC name is 5-[bis[[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[bis[[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 54753874 |
| Molecular Formula | C21H14Cl2N2O4S3 |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 523.95 |
| IUPAC Name | 5-[bis[[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1=C(SCC(=O)c1ccc(Cl)cc1)SCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H14Cl2N2O4S3/c22-13-5-1-11(2-6-13)15(26)9-31-20(17-18(28)24-21(30)25-19(17)29)32-10-16(27)12-3-7-14(23)8-4-12/h1-8H,9-10H2,(H2,24,25,28,29,30) |
| InChIKey | UMZKOURVUOADBA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|