C19H15ClN2O3S — CID 3834503
5-[3-(4-chlorophenyl)-3-oxo-1-phenylpropyl]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 3834503) has the molecular formula C19H15ClN2O3S and a molecular weight of 386.86 g/mol. Its IUPAC name is 5-[3-(4-chlorophenyl)-3-oxo-1-phenylpropyl]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[3-(4-chlorophenyl)-3-oxo-1-phenylpropyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 3834503 |
| Molecular Formula | C19H15ClN2O3S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 5-[3-(4-chlorophenyl)-3-oxo-1-phenylpropyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C(CC(c1ccccc1)C1C(=O)NC(=S)NC1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15ClN2O3S/c20-13-8-6-12(7-9-13)15(23)10-14(11-4-2-1-3-5-11)16-17(24)21-19(26)22-18(16)25/h1-9,14,16H,10H2,(H2,21,22,24,25,26) |
| InChIKey | FEVNMEFTUJEWPE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|