C20H15ClN2O4S — CID 24881173
5-[1-(4-chlorophenyl)-1,4-dioxo-4-phenylbutan-2-yl]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 24881173) has the molecular formula C20H15ClN2O4S and a molecular weight of 414.87 g/mol. Its IUPAC name is 5-[1-(4-chlorophenyl)-1,4-dioxo-4-phenylbutan-2-yl]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[1-(4-chlorophenyl)-1,4-dioxo-4-phenylbutan-2-yl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 24881173 |
| Molecular Formula | C20H15ClN2O4S |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 5-[1-(4-chlorophenyl)-1,4-dioxo-4-phenylbutan-2-yl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C(CC(C(=O)c1ccc(Cl)cc1)C1C(=O)NC(=S)NC1=O)c1ccccc1 |
| InChI | InChI=1S/C20H15ClN2O4S/c21-13-8-6-12(7-9-13)17(25)14(10-15(24)11-4-2-1-3-5-11)16-18(26)22-20(28)23-19(16)27/h1-9,14,16H,10H2,(H2,22,23,26,27,28) |
| InChIKey | NQQNCSKHFBGWEE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|