C20H16N2O5 — CID 24882062
5-(1,4-dioxo-1,4-diphenylbutan-2-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 24882062) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is 5-(1,4-dioxo-1,4-diphenylbutan-2-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(1,4-dioxo-1,4-diphenylbutan-2-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 24882062 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 5-(1,4-dioxo-1,4-diphenylbutan-2-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(C(CC(=O)c2ccccc2)C(=O)c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C20H16N2O5/c23-15(12-7-3-1-4-8-12)11-14(17(24)13-9-5-2-6-10-13)16-18(25)21-20(27)22-19(16)26/h1-10,14,16H,11H2,(H2,21,22,25,26,27) |
| InChIKey | JXIUNCIIFPMYBY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|