C15H12N4O6 — CID 2042273
5-[phenyl-(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 2042273) has the molecular formula C15H12N4O6 and a molecular weight of 344.28 g/mol. Its IUPAC name is 5-[phenyl-(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[phenyl-(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2042273 |
| Molecular Formula | C15H12N4O6 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 5-[phenyl-(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(C(c2ccccc2)C2C(=O)NC(=O)NC2=O)C(=O)N1 |
| InChI | InChI=1S/C15H12N4O6/c20-10-8(11(21)17-14(24)16-10)7(6-4-2-1-3-5-6)9-12(22)18-15(25)19-13(9)23/h1-5,7-9H,(H2,16,17,20,21,24)(H2,18,19,22,23,25) |
| InChIKey | XYHLLXVXFQYTDN-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|