C19H16N2O4 — CID 24881984
4-(1,4-dioxo-1,4-diphenylbutan-2-yl)pyrazolidine-3,5-dione (PubChem CID 24881984) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 4-(1,4-dioxo-1,4-diphenylbutan-2-yl)pyrazolidine-3,5-dione.
| Compound Name | 4-(1,4-dioxo-1,4-diphenylbutan-2-yl)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 24881984 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-(1,4-dioxo-1,4-diphenylbutan-2-yl)pyrazolidine-3,5-dione |
| SMILES | O=C(CC(C(=O)c1ccccc1)C1C(=O)NNC1=O)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O4/c22-15(12-7-3-1-4-8-12)11-14(16-18(24)20-21-19(16)25)17(23)13-9-5-2-6-10-13/h1-10,14,16H,11H2,(H,20,24)(H,21,25) |
| InChIKey | PADJGJZVJIYCSN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|