C19H16N2O4 — CID 44614778
2-(3-amino-5-oxo-4H-1,2-oxazol-4-yl)-1,4-diphenylbutane-1,4-dione (PubChem CID 44614778) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-(3-amino-5-oxo-4H-1,2-oxazol-4-yl)-1,4-diphenylbutane-1,4-dione.
| Compound Name | 2-(3-amino-5-oxo-4H-1,2-oxazol-4-yl)-1,4-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 44614778 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-(3-amino-5-oxo-4H-1,2-oxazol-4-yl)-1,4-diphenylbutane-1,4-dione |
| SMILES | NC1=NOC(=O)C1C(CC(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O4/c20-18-16(19(24)25-21-18)14(17(23)13-9-5-2-6-10-13)11-15(22)12-7-3-1-4-8-12/h1-10,14,16H,11H2,(H2,20,21) |
| InChIKey | BJGGTNAQXKKAKT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|