C21H20O5 — CID 122373277
ethyl (2S)-4-oxo-2-[(3S)-2-oxo-3,4-dihydrochromen-3-yl]-4-phenylbutanoate (PubChem CID 122373277) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is ethyl (2S)-4-oxo-2-[(3S)-2-oxo-3,4-dihydrochromen-3-yl]-4-phenylbutanoate.
| Compound Name | ethyl (2S)-4-oxo-2-[(3S)-2-oxo-3,4-dihydrochromen-3-yl]-4-phenylbutanoate |
|---|---|
| PubChem CID | 122373277 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | ethyl (2S)-4-oxo-2-[(3S)-2-oxo-3,4-dihydrochromen-3-yl]-4-phenylbutanoate |
| SMILES | CCOC(=O)[C@@H](CC(=O)c1ccccc1)[C@@H]1Cc2ccccc2OC1=O |
| InChI | InChI=1S/C21H20O5/c1-2-25-20(23)17(13-18(22)14-8-4-3-5-9-14)16-12-15-10-6-7-11-19(15)26-21(16)24/h3-11,16-17H,2,12-13H2,1H3/t16-,17-/m0/s1 |
| InChIKey | XEOBHDSZJYSPAO-IRXDYDNUSA-N |
| XLogP | 3.22 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|